Chuyên đề: Hidrocacbon no

Với Chuyên đề: Hidrocacbon no Hoá học lớp 11 tổng hợp các dạng bài tập, trên 200 bài tập trắc nghiệm có lời giải chi tiết với đầy đủ phương pháp giải, ví dụ minh họa sẽ giúp học sinh ôn tập, biết cách làm dạng bài tập Hidrocacbon no từ đó đạt điểm cao trong bài thi môn Hoá học lớp 11.

Bạn đang xem: Chuyên đề: hidrocacbon no

*

Tổng hợp Lý thuyết chương Hidrocacbon no

Phương pháp giải các dạng bài tập chương Hidrocacbon no

Bài tập trắc nghiệm

Dạng bài tập về đồng phân, gọi tên Ankan, Xicloankan

A. Bài tập tự luận

Bài 1: Số đồng phân cấu tạo mạch hở ứng với công thức phân tử C5H12 là

Hướng dẫn:

*

⇒ 3 đồng phân

Bài 2: Số đồng phân cấu tạo mạch hở ứng với công thức phân tử C6H14 là

Hướng dẫn:

*

⇒5 đồng phân

Bài 3: Hợp chất (CH3)2CHCH2CH2CH3 có tên gọi là

Hướng dẫn:

2- metylpentan

Bài 4: Viết CTCT các chất có tên gọi sau :

a) 4-etyl-3,3-đimetylhexan

b) 1-brom-2-clo-3-metylpentan

c) 1,2-điclo-3-metylbutan

d) 2,2,3-trimetylpentan.

Hướng dẫn:

a. CH3-CH2-C(CH3)2-CH(C2H5)-CH2-CH3

b. CH2Br-CHCl-CH(CH3)-CH2-CH3

c. CH2Cl-CHCl-CH(CH3)-CH3

d. CH3-C(CH3)2-CH(CH3)-CH2-CH3

B. Bài tập trắc nghiệm

Bài 1: Công thức tổng quát của ankan là

A. CnHn+2 B. CnH2n+2 C. CnH2n D. CnH2n-2.

Lời giải:

Đáp án: B

Bài 2: Dãy nào sau đây chỉ gồm các chất thuộc dãy đồng đẳng của metan.

A. C2H2, C3H4, C4H6, C5H8 B. CH4, C2H2, C3H4, C4H10

C. CH4, C2H6, C4H10, C5H12 D. C2H6, C3H8, C5H10, C6H12

Lời giải:

Đáp án: C

Bài 3: Có bao nhiêu đồng phân cấu tạo mạch hở có công thức phân tử C5H12?

A. 6 B. 4 C. 5 D. 3

Lời giải:

Đáp án: D

Bài 4: Ankan X có công thức phân tử C5H12. Clo hóa X, thu được 4 sản phẩm dẫn xuất monoClo. Tên gọi của X là

A. 2,2-đimetylprotan B. 2- metylbutan

C. pentan D. 2- đimetylpropan

Lời giải:

Đáp án: B

Bài 5: Ankan X có công thức phân tử C6H14. Clo hóa X, thu được 4 sản phẩm dẫn xuất monoClo. Tên gọi của X là

A. 2,2-đimetylbutan B. 2- metylpentan

C. hexan D. 3- metylpentan

Lời giải:

Đáp án: D

Bài 6: CTCT nào sau đây có tên gọi là: isopentan

A. C(CH3)3

B. CH3CH2CH(CH3)CH3

C. CH3CH2CH(CH3)CH2CH3

D. CH3CH(CH3)CH2CH2CH3

Lời giải:

Đáp án: B

Bài 7: Hợp chất hữu cơ X có tên gọi là: 2 - Clo - 3 - metylpentan. Công thức cấu tạo của X là:

A. CH3CH2CH(Cl)CH(CH3)2

B.CH3CH(Cl)CH(CH3)CH2CH3

C. CH3CH2CH(CH3)CH2CH2Cl

D.CH3CH(Cl)CH2CH(CH3)CH3

Lời giải:

Đáp án: B

Bài 8: Ankan (CH3)2CHCH2C(CH3)3 có tên gọi là

A. 2,2,4-trimetylpentan

B. 2,2,4,4-tetrametytan

C. 2,4,4-trimetyltan

D. 2,4,4,4-tetrametylbutan

Lời giải:

Đáp án: A

Phản ứng để hidro hóa và cracking ankan

A. Phương pháp giải & Ví dụ minh họa

- Dưới tác dụng của nhiệt độ, xúc tác, ankan có thể phản ứng theo nhiều hướng:

Phản ứng crackinh: ANKAN −tº, xt→ ANKAN KHÁC + ANKEN (làm mất màu dd brom)

Phản ứng đề hydro hóa: ANKAN −tº, xt→ ANKEN + H2

Ví dụ:

C3H8 −tº, xt→ CH4 + C2H4 (CH2=CH2)

C3H8 −tº, xt→ C3H6 (CH2=CH–CH3) + H2

Đặc biệt, trong điều kiện thích hợp phản ứng còn có thể:

+ Tạo ra ankin: Ví dụ: 2CH4 −1500ºC, lln→ CH≡CH + 3H2

+ Tạo ra cabon và hydro: Ví dụ: CH4 −tº, xt→ C (rắn) + 2H2

- Phản ứng không làm thay đổi khối lượng hỗn hợp:

mtrước phản ứng = msau phản ứng ⇒ Mđ/Ms = ns/nđ

hàm lượng C và H trước và sau phản ứng là như nhau ⇒ đốt cháy hỗn hợp sau phản ứng được qui về đốt cháy hỗn hợp trước phản ứng.

- Phản ứng luôn làm tăng số mol khí: nsau > ntrước ⇒ Psau > Pđầu ⇒ Mtb sau tb đầu (vì mđầu = msau)

Ví dụ: C3H8 −tº, xt→ CH4 + C2H4 ⇒ nsau = 2. Nđầu

- Số mol anken sinh ra : nanken = ns – nđ; Hiệu suất phản ứng: H = (ns- nđ)/nđ .100%

Ví dụ minh họa

Bài 1: Crackinh butan thu được 35 mol hh A gồm CH4, C2H6, H2, C2H4, C3H6, C4H8 và C4H10 dư. Dẫn A lội qua bình nước brom dư thấy có 20 mol khí đi ra khỏi bình (biết rằng chỉ có C2H4, C3H6, C4H8 phản ứng với Br2 và đều theo tỉ lệ số mol 1:1). Nếu đốt cháy hoàn toàn A thì thu được a mol CO2.

a. Tính hiệu suất phản ứng tạo hh A.

b. Tính giá trị của a.

Hướng dẫn:

a. Phương trình phản ứng:

C4H10 −tº, xt→ CH4 + C3H6

C4H10 −tº, xt→ C2H6 + C2H4

C4H10 −tº, xt→ H2 + C4H8

Số mol anken thu được: nanken= 35 - 20 = 15mol

Số mol butan ban đầu là: nđ = nbutan = ns - nanken = 35 – 15 = 20 mol

Hiệu suất cracking butan là H = (ns- nđ)/nđ .100% = (35-20)/20.100% = 75%

b. Đốt cháy hỗn hợp A là đốt chay butan:

C4H10 + 11/2O2 → 4CO2 + 5H2O

20 80 mol

Vậy số mol CO2 thu được khi đốt cháy hỗn hợp A là 80 mol

Bài 2: Craking m gam n-butan thu được hợp A gồm H2, CH4, C2H4, C2H6, C3H6, C4H8 và một phần butan chưa bị craking. Đốt cháy hoàn toàn A thu được 9 gam H2O và 17,6 gam CO2. Giá trị của m là

Hướng dẫn:

nbutan = nH2O – nCO2 = 9/18 - 17,6/44 = 0,1 mol; m = 0,1.58 = 5,8 gam

Bài 3: Crackinh propan thu được 67,2 lít (đktc) hỗn hợp X gồm H2, C3H6, CH4, C2H4, C3H8. Dẫn toàn bộ X vào bình đựng dung dịch Br2 dư thì thấy có 160 gam brom phản ứng (biết rằng chỉ có C2H4, C3H6 phản ứng với Br2 và đều theo tỉ lệ số mol 1:1). Vậy % propan đã phản ứng là:

Hướng dẫn:

nX = 67,2/22,4 = 3 mol; nanken = nBr2 = 160/160 = 1 mol; npropan = 3-1 = 2 mol; H = (3-2)/2.100% = 50%

Bài 4: Đề hidro hóa hỗn hợp A gồm: C2H6, C3H8 , C4H10. Sau một thời gian thu được hỗn hợp khí B, dA/B =1,75. % ankan bị đề hiadro hóa là:

Hướng dẫn:

MA/MB = 1,75 ⇒ H = (MA- MB)/MB .100% = (1,75-1)/1 .100% = 75%

Bài 5: Một hỗn hợp X gồm hai ankan A, B đồng đẳng kế tiếp. Crackinh 11,2 lít (đktc) hỗn hợp X thu được 22,4 lít hỗn hợp Y (đktc) gồm ankan, anken và H2, tỉ khối hơi của Yđối với H2 là 8,2. Vậy công thức phân tử và số mol của A, B lần lượt là:

Hướng dẫn:

MY/MX = nX/nY = 1/2 ; MY = 8,2.2 = 16,4; MX = 16,4.2 = 32,8 = 14ntb + 2 ⇒ ntb = 2,2

CTPT của A và B lần lượt là: C2H6 ; C3H8; nA/nB = 4/1 = 0,4/0,1

B. Bài tập trắc nghiệm

Bài 1: Khi crackinh hoàn toàn một thể tích ankan X thu được ba thể tích hỗn hợp Y (các thể tích khí đo ở cùng điều kiện nhiệt độ và áp suất); tỉ khối của Y so với H2 bằng 12. Công thức phân tử của X là:

A. C6H14. B. C3H8. C. C4H10. D. C5H12.

Lời giải:

Đáp án: D

Nhận xét: Trong phản ứng cacking M(trước) = M(sau).

Vậy: M(X) = 3M(Y). d(Y/H2) = 12 ⇒ M(Y) = 24 ⇒ M(X) = 72.

Bài 2: Craking 8,8 gam propan thu được hỗn hợp A gồm H2, CH4, C2H4, C3H6 và một phần propan chưa bị craking. Biết hiệu suất phản ứng là 90%. Khối lượng phân tử trung bình của A là:

A. 39,6. B. 23,16. C. 2,315. D. 3,96.

Lời giải:

Đáp án: B

Ta có: a = 0.18, b = 0.02 (a là số mol C3H8 phản ứng, b là số mol C3H8dư).

số mol A = 2a + b = 0.38

Mtb = 8.8/0.38 = 23.16

Bài 3: Craking 2,24 lít butan thu được hỗn hợp A gồm H2, CH4 ,C2H4 ,C2H6 C3H6, C4H8, C4H10. Hỗn hợp khí A phản ứng vừa đủ với 100 ml dung dịch Br2 0,2 M. Hiệu suất phản ứng cracking butan là:

A. 80%. B. 75%. C. 25%. D. 20%.

Lời giải:

Đáp án: D

nanken = nBr2 = 0,02 mol; nbutan = 2,24/22,4 = 0,1 mol; nA = 0,1 + 0,02 = 0,12 mol;

H = (0,12-0,1)/0,1=20%

Bài 4: Crackinh 8,8 gam propan thu được hh A gồm H2, CH4, C2H4, C3H6 và một phần propan chưa bị crackinh. Biết % propan phản ứng là 90%. Khối lượng phân tử trung bình của A là:

A. 39,6 B. 23,16 C. 2,315 D. 3,96.

Lời giải:

Đáp án: B

npropan = 8,8/44 = 0,2 mol; H = (nA- npropan)/npropan .100% ⇒ nA = 0,38 mol ⇒ MA = 8,8/0,38 =23,16 g/mol

Bài 5: Khi crackinh hoàn toàn V lit ankan X thu được 3V lit hh Y (các thể tích khí đo ở cùng điều kiện nhiệt độ và áp suất); tỉ khối của Y so với H2 bằng 12. CTPT của X là:

A. C6H14 B. C3H8 C. C4H10 D. C5H12

Lời giải:

Đáp án: D

VX/VY = nX/nY = 1/3 ; MY = 12.2 = 24; ta có nX/nY = MY/MX = 1/3 ⇒ MX = 24.3 = 72 ⇒ CTPT của X: C5H12

Bài 6: Khi crackinh hoàn toàn một thể tích hexan (X) thu được bốn thể tích hỗn hợp Y(các thể tích khí đo ở cùng điều kiện nhiệt độ và áp suất); tỉ khối của Y so với H2 bằng d. Giá trị của d là

A. 10,25 B. 10,5. C. 10,75. D. 9,5.

Lời giải:

Đáp án: C

VX/VY = nX/nY = 1/4; nX/nY = MY/MX = 1/4 ⇒ MY = 86/4 = 21,5 ; dY/H2 = 21,5/2 = 10,75

Bài 7: Nung một lượng butan trong bình kín (cố xúc tác thích hợp) thu được hỗn hợp X gồm ankan và anken. Tỉ khối của X so với khí hiđro là 21,75. Thành phần phần trăm thể tích của butan trong X là:

A. 25,00 B. 66,67 C. 50,00 D. 33,33.

Lời giải:

Đáp án: C

MX = 21,75.2 = 43,5. Chọn số mol hỗn hợp X là 1 mol

C4H10 → CnH2n+2 + CmH2m

a mol a mol a mol

BTKL:

⇒ a = 1 – 0,75 = 0,25 mol ⇒ C4H10 còn dư: 0,75 – 0,25 = 0,5 mol

⇒ % thể tích C4H10 trong X là 50%

Bài 8: Craking 8,8 gam propan thu được hỗn hợp A gồm H2, CH4, C2H4, C3H6 và một phần propan chưa bị craking. Biết hiệu suất phản ứng là 90%. Khối lượng phân tử trung bình của A là:

A. 39,6. B. 23,16. C. 2,315. D. 3,96.

Lời giải:

Đáp án: B

Ta có số mol chất sản phẩm n sp = nC3H8 dư + 2.nC3H8 phản ứng = 0,02 + 2.0,18 = 0,38⇒ M = 8,8 : 0,38 = 23,16

Các dạng bài tập về Xicloankan

A. Bài tập tự luận

Bài 1: Chất khí A là 1 xicloankan. Khi đốt cháy 672 ml A(đktc), thì thấy khối lượng CO2 tạo thành nhiều hơn khối lượng nước tạo thành 3,12 g.

a. Xác định công thức phân tử.

b. Viết công thức cấu tạo và tên các xicloankan ứng với công thức phân tử tìm được.

c. Cho chất A qua dung dịch brom, màu của dung dịch mất đi. Xác định công thức cấu tạo đúng của chất A.

Hướng dẫn:

Số mol khí A là: nA = 0,672/22,4 = 0,03 mol; đốt cháy xicloankan: nCO2 = nH2O = x

Khối lượng CO2 lớn hơn khối lượng H2O là 3,12 gam: mCO2 – mH2O = 44x – 18x = 26x = 3,12 ⇒ x = 0,12 mol.

a. Phương trình đốt cháy:

*

n = 0,12/0,03 = 4

Vậy CTPT của xicloankan là: C4H8

b. Các đồng phân cấu tạo xicloankan của C4H8 là:

*

c. Chất A làm mất màu dung dịch nước brom. Vậy CTCT của A là

*

Bài 2: Số đồng phân xicloankan ứng với CTPT C5H10:

Hướng dẫn:

*

Bài 3: Oxi hóa hoàn toàn 0,224 lit ( đktc) xicloankan X thu được 1,760g khí CO2. Biết X làm mất màu dd brom. X là:

Hướng dẫn:

CTPT X là CnH2n ; n = 0,04/0,01 = 4 ⇒ CTCT của X là :

*

Bài 4: Đốt cháy hoàn toàn một xicloankan A thu được hỗn hợp khí và hơi. Dẫn toàn bộ hỗn hợp đó qua bình đựng dung dịch Ba(OH)2 dư thấy tạo ra 9,85 gam kết tủa. Khối lượng dung dịch sau phản ứng tăng hay giảm bao nhiêu gam?

Hướng dẫn:

nH2O = nCO2 = nBaCO3 = 9,85/197 = 0,05 mol ⇒ mH2O = 0,05.18 = 0,9 gam; mCO2 = 0,05.44 = 2,2 gam; mgiảm= 9,85 – (0,9 + 2,2) = 6,75.

Bài 5: Hỗn hợp khí A chứa một ankan và một monoxicloankan. Tỉ khối của A đối với hiđro là 25,8. Đốt cháy hoàn toàn 2,58 g A rồi hấp thụ hết sản phẩm cháy vào dung dịch Ba(OH)2 dư, thu được 35,46 g kết tủa. Công thức phân tử của các chất trong hỗn hợp A là

Hướng dẫn:

nCO2 = nBaCO3 = 35,46/197 = 0,18 mol; nA= 2,58/51,6 = 0,05 mol; mH = 2,58 – 0,18.12 = 0,42 gam ⇒ nH2O = 0,21 mol; nankan = 0,21 – 0,18 = 0,03 mol ⇒ nxicloankan = 0,02 mol;

CTPT của ankan và xicloankan lần lượt là: CnH2n+2 và CmH2m; ta có: 0,02n + 0,03m = 0,18 ⇔ 2n + 3m = 18 ⇒ n = 3 và m = 4.

B. Bài tập trắc nghiệm

Bài 1: Oxi hóa hoàn toàn 0,224 lit ( đktc) xicloankan X thu được 1,760g khí CO2. Biết X làm mất màu dd brom. X là:

A. Metylxiclobutan B. xiclopropan

C. xiclobutan D. Metylxiclopropan.

Lời giải:

Đáp án: D

CTPT X là CnH2n ; n = 0,04/0,01 = 4 ⇒ CTCT của X là :

*

Bài 2: Có những chất sau : xiclopropan, xiclobutan, metylxiclopropan, xiclopentan . Những chất nào có khả năng làm mất màu nước brom ở điều kiện thường .

A. xiclopropan và metylxiclopropan

B. xiclopropan và xiclobutan

C. xiclopropan

D. xiclopropan, xiclobutan và Metylxiclopropan.

Lời giải:

Đáp án: A

Bài 3: Khi cho Metylxiclopentan tác dụng với clo ( askt) có thể thu được mấy dẫn xuất monoclo

A. 4 B. 5 C. 6 D. 7

Lời giải:

Đáp án: A

Các vị trí có thể tham gia thế clo được biểu diễn như sau:

*

Bài 4: Đun hỗn hợp khí A gồm propan và xiclopropan đi vào dung dịch brom sẽ quan sát được hiện tượng nào sau đây :

A. Màu của dung dịch nhạt dần, không có khí thoát ra.

B. Màu của dung dịch nhạt dần và có khí thoát ra.

C. Màu của dung dịch mất hẳn, không còn khí thoát ra.

D. Màu của dung dịch không đổi.

Lời giải:

Đáp án: B

Bài 5: Xicloankan (chỉ có một vòng) A có tỉ khối so với nitơ bằng 3. A tác dụng với clo có chiếu sáng chỉ cho một dẫn xuất monoclo duy nhất, xác định công thức cấu tạo cuả A?

Lời giải:

Đáp án: A

MA = 3.28 = 84 = 14n ⇒ n = 6 ⇒ CTCT của A

Bài 6: Hỗn hợp B gồm một ankan và 1 xicloankan. Dẫn m g B qua bình chứa nước brom dư thì khối lượng bình tăng 4,2 gam. Đốt cháy hoàn toàn m gam B thu được 11,2 lit CO2 (đktc) và 10,8 gam H2O. Thành phần % khối lượng ankan trong B là?.

A. 41,67% B. 34,36% C.

Xem thêm: Mô Tả Công Việc Content Marketing Chi Tiết Nhất 2020, Mô Tả Công Việc Content Marketing

52,81% D. 29,28%

Lời giải:

Đáp án: A

Khối lượng bình brom tăng là khối lượng của xicloankan: mxicloankan = 4,2 gam

nH2O = 10,8/18 = 0,6 mol; nCO2 = 11,2/22,4 = 0,5 mol

mB = mC + mH = 0,5.12 + 0,6.2 = 7,2 gam

⇒ mankan = 7,2 – 4,2 = 3 gam

⇒ %(m)ankan = 3.110%/7,2 = 41,67%

Bài 7: Xicloankan (chỉ có một vòng) A có tỉ khối so với nitơ bằng 3. A tác dụng với clo có chiếu sáng chỉ cho một dẫn xuất monoclo duy nhất, xác định công thức cấu tạo cuả A?

Lời giải:

Đáp án: A

MA = 3.28 = 84 = 14n ⇒ n = 6 ⇒ CTCT của A

Bài 8: Xicloankan A phản ứng với Cl2 ánh sáng thu được dẫn xuất monoclo B (trong đó clo chiếm 34% về khối lượng). Biết B có 4 đồng phân. Tên gọi của hợp chất A là: